C44H74O7SSi2 — CID 10700553
[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2R,5R)-5-[(2S,5R)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxyundecyl]oxolan-2-yl]oxolan-2-yl]ethyl] methanesulfonate (PubChem CID 10700553) has the molecular formula C44H74O7SSi2 and a molecular weight of 803.31 g/mol. Its IUPAC name is [(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2R,5R)-5-[(2S,5R)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxyundecyl]oxolan-2-yl]oxolan-2-yl]ethyl] methanesulfonate.
| Compound Name | [(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2R,5R)-5-[(2S,5R)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxyundecyl]oxolan-2-yl]oxolan-2-yl]ethyl] methanesulfonate |
|---|---|
| PubChem CID | 10700553 |
| Molecular Formula | C44H74O7SSi2 |
| Molecular Weight | 803.31 g/mol |
| Exact Mass | 802.47 |
| IUPAC Name | [(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2R,5R)-5-[(2S,5R)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxyundecyl]oxolan-2-yl]oxolan-2-yl]ethyl] methanesulfonate |
| SMILES | CCCCCCCCCC[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1CC[C@@H]([C@H]2CC[C@H]([C@H](CO[Si](C)(C)C(C)(C)C)OS(C)(=O)=O)O2)O1 |
| InChI | InChI=1S/C44H74O7SSi2/c1-11-12-13-14-15-16-17-24-29-41(51-54(44(5,6)7,35-25-20-18-21-26-35)36-27-22-19-23-28-36)39-32-30-37(48-39)38-31-33-40(49-38)42(50-52(8,45)46)34-47-53(9,10)43(2,3)4/h18-23,25-28,37-42H,11-17,24,29-34H2,1-10H3/t37-,38+,39+,40+,41+,42-/m0/s1 |
| InChIKey | CIGBWCNMRSFYGZ-GKMBSBAISA-N |
| XLogP | 9.92 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.31 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|