C29H54O2SSiSn — CID 25139411
tert-butyl-dimethyl-[(E)-4-[(S)-(4-methylphenyl)sulfinyl]-4-tributylstannylbut-3-enoxy]silane (PubChem CID 25139411) has the molecular formula C29H54O2SSiSn and a molecular weight of 613.61 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E)-4-[(S)-(4-methylphenyl)sulfinyl]-4-tributylstannylbut-3-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E)-4-[(S)-(4-methylphenyl)sulfinyl]-4-tributylstannylbut-3-enoxy]silane |
|---|---|
| PubChem CID | 25139411 |
| Molecular Formula | C29H54O2SSiSn |
| Molecular Weight | 613.61 g/mol |
| Exact Mass | 614.26 |
| IUPAC Name | tert-butyl-dimethyl-[(E)-4-[(S)-(4-methylphenyl)sulfinyl]-4-tributylstannylbut-3-enoxy]silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C/CCO[Si](C)(C)C(C)(C)C)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H27O2SSi.3C4H9.Sn/c1-15-9-11-16(12-10-15)20(18)14-8-7-13-19-21(5,6)17(2,3)4;3*1-3-4-2;/h8-12H,7,13H2,1-6H3;3*1,3-4H2,2H3;/t20-;;;;/m1..../s1 |
| InChIKey | BJNZCHOOWAXCKK-YFDXKITBSA-N |
| XLogP | 9.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.61 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|