C26H30O3SSi — CID 10863309
tert-butyl-[[(2R,3R)-3-[(S)-(4-methylphenyl)sulfinyl]oxiran-2-yl]methoxy]-diphenylsilane (PubChem CID 10863309) has the molecular formula C26H30O3SSi and a molecular weight of 450.68 g/mol. Its IUPAC name is tert-butyl-[[(2R,3R)-3-[(S)-(4-methylphenyl)sulfinyl]oxiran-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2R,3R)-3-[(S)-(4-methylphenyl)sulfinyl]oxiran-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10863309 |
| Molecular Formula | C26H30O3SSi |
| Molecular Weight | 450.68 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | tert-butyl-[[(2R,3R)-3-[(S)-(4-methylphenyl)sulfinyl]oxiran-2-yl]methoxy]-diphenylsilane |
| SMILES | Cc1ccc([S@](=O)[C@H]2O[C@@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H30O3SSi/c1-20-15-17-21(18-16-20)30(27)25-24(29-25)19-28-31(26(2,3)4,22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-18,24-25H,19H2,1-4H3/t24-,25-,30+/m1/s1 |
| InChIKey | ZXKFGIJSFFTBEL-KQZWIPHESA-N |
| XLogP | 4.40 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.68 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|