C29H36O3SSi — CID 101461761
(E,2S)-5-[tert-butyl(diphenyl)silyl]oxy-3-methyl-1-(4-methylphenyl)sulfinylpent-3-en-2-ol (PubChem CID 101461761) has the molecular formula C29H36O3SSi and a molecular weight of 492.76 g/mol. Its IUPAC name is (E,2S)-5-[tert-butyl(diphenyl)silyl]oxy-3-methyl-1-(4-methylphenyl)sulfinylpent-3-en-2-ol.
| Compound Name | (E,2S)-5-[tert-butyl(diphenyl)silyl]oxy-3-methyl-1-(4-methylphenyl)sulfinylpent-3-en-2-ol |
|---|---|
| PubChem CID | 101461761 |
| Molecular Formula | C29H36O3SSi |
| Molecular Weight | 492.76 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | (E,2S)-5-[tert-butyl(diphenyl)silyl]oxy-3-methyl-1-(4-methylphenyl)sulfinylpent-3-en-2-ol |
| SMILES | C/C(=C\CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](O)CS(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H36O3SSi/c1-23-16-18-25(19-17-23)33(31)22-28(30)24(2)20-21-32-34(29(3,4)5,26-12-8-6-9-13-26)27-14-10-7-11-15-27/h6-20,28,30H,21-22H2,1-5H3/b24-20+/t28-,33?/m1/s1 |
| InChIKey | HVOGAHHYSBTKSH-IKAKQBHPSA-N |
| XLogP | 4.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.76 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|