C34H40BrNO5S2Si — CID 101338892
N-[(2S,3R,4S)-1-(benzenesulfinyl)-3-bromo-5-[tert-butyl(diphenyl)silyl]oxy-4-hydroxypentan-2-yl]-4-methylbenzenesulfonamide (PubChem CID 101338892) has the molecular formula C34H40BrNO5S2Si and a molecular weight of 714.82 g/mol. Its IUPAC name is N-[(2S,3R,4S)-1-(benzenesulfinyl)-3-bromo-5-[tert-butyl(diphenyl)silyl]oxy-4-hydroxypentan-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2S,3R,4S)-1-(benzenesulfinyl)-3-bromo-5-[tert-butyl(diphenyl)silyl]oxy-4-hydroxypentan-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 101338892 |
| Molecular Formula | C34H40BrNO5S2Si |
| Molecular Weight | 714.82 g/mol |
| Exact Mass | 713.13 |
| IUPAC Name | N-[(2S,3R,4S)-1-(benzenesulfinyl)-3-bromo-5-[tert-butyl(diphenyl)silyl]oxy-4-hydroxypentan-2-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CS(=O)c2ccccc2)[C@@H](Br)[C@@H](O)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C34H40BrNO5S2Si/c1-26-20-22-28(23-21-26)43(39,40)36-31(25-42(38)27-14-8-5-9-15-27)33(35)32(37)24-41-44(34(2,3)4,29-16-10-6-11-17-29)30-18-12-7-13-19-30/h5-23,31-33,36-37H,24-25H2,1-4H3/t31-,32-,33+,42?/m0/s1 |
| InChIKey | SVGUULKFCXSPER-BRMGEGIZSA-N |
| XLogP | 5.15 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.82 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|