C21H28BrNO4S2 — CID 11420680
N-[(2S,3S,4S)-3-bromo-4-hydroxy-1-[(R)-phenylsulfinyl]octan-2-yl]-4-methylbenzenesulfonamide (PubChem CID 11420680) has the molecular formula C21H28BrNO4S2 and a molecular weight of 502.50 g/mol. Its IUPAC name is N-[(2S,3S,4S)-3-bromo-4-hydroxy-1-[(R)-phenylsulfinyl]octan-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2S,3S,4S)-3-bromo-4-hydroxy-1-[(R)-phenylsulfinyl]octan-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11420680 |
| Molecular Formula | C21H28BrNO4S2 |
| Molecular Weight | 502.50 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | N-[(2S,3S,4S)-3-bromo-4-hydroxy-1-[(R)-phenylsulfinyl]octan-2-yl]-4-methylbenzenesulfonamide |
| SMILES | CCCC[C@H](O)[C@@H](Br)[C@H](C[S@@](=O)c1ccccc1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H28BrNO4S2/c1-3-4-10-20(24)21(22)19(15-28(25)17-8-6-5-7-9-17)23-29(26,27)18-13-11-16(2)12-14-18/h5-9,11-14,19-21,23-24H,3-4,10,15H2,1-2H3/t19-,20-,21-,28+/m0/s1 |
| InChIKey | MXHCKWWYTBTWPK-MLWROCFZSA-N |
| XLogP | 3.76 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|