C21H27NO2S — CID 5461273
N-[(1S,2R)-2-ethenyl-1-phenylhexyl]-4-methylbenzenesulfonamide (PubChem CID 5461273) has the molecular formula C21H27NO2S and a molecular weight of 357.52 g/mol. Its IUPAC name is N-[(1S,2R)-2-ethenyl-1-phenylhexyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1S,2R)-2-ethenyl-1-phenylhexyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 5461273 |
| Molecular Formula | C21H27NO2S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-[(1S,2R)-2-ethenyl-1-phenylhexyl]-4-methylbenzenesulfonamide |
| SMILES | C=C[C@@H](CCCC)[C@H](NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO2S/c1-4-6-10-18(5-2)21(19-11-8-7-9-12-19)22-25(23,24)20-15-13-17(3)14-16-20/h5,7-9,11-16,18,21-22H,2,4,6,10H2,1,3H3/t18-,21-/m0/s1 |
| InChIKey | QGRLNNVRHZJIAA-RXVVDRJESA-N |
| XLogP | 5.01 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|