C16H22F3NO2S — CID 10497984
N-(3-ethenyl-1,1,1-trifluoroheptan-2-yl)-4-methylbenzenesulfonamide (PubChem CID 10497984) has the molecular formula C16H22F3NO2S and a molecular weight of 349.42 g/mol. Its IUPAC name is N-(3-ethenyl-1,1,1-trifluoroheptan-2-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(3-ethenyl-1,1,1-trifluoroheptan-2-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10497984 |
| Molecular Formula | C16H22F3NO2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | N-(3-ethenyl-1,1,1-trifluoroheptan-2-yl)-4-methylbenzenesulfonamide |
| SMILES | C=CC(CCCC)C(NS(=O)(=O)c1ccc(C)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H22F3NO2S/c1-4-6-7-13(5-2)15(16(17,18)19)20-23(21,22)14-10-8-12(3)9-11-14/h5,8-11,13,15,20H,2,4,6-7H2,1,3H3 |
| InChIKey | FSNLXKZURHWVMA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|