C16H20F3NO5S3 — CID 101395253
ethyl (2S,3R)-2-ethoxycarbothioylsulfanyl-4,4,4-trifluoro-3-[(4-methylphenyl)sulfonylamino]butanoate (PubChem CID 101395253) has the molecular formula C16H20F3NO5S3 and a molecular weight of 459.53 g/mol. Its IUPAC name is ethyl (2S,3R)-2-ethoxycarbothioylsulfanyl-4,4,4-trifluoro-3-[(4-methylphenyl)sulfonylamino]butanoate.
| Compound Name | ethyl (2S,3R)-2-ethoxycarbothioylsulfanyl-4,4,4-trifluoro-3-[(4-methylphenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 101395253 |
| Molecular Formula | C16H20F3NO5S3 |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | ethyl (2S,3R)-2-ethoxycarbothioylsulfanyl-4,4,4-trifluoro-3-[(4-methylphenyl)sulfonylamino]butanoate |
| SMILES | CCOC(=O)[C@@H](SC(=S)OCC)[C@H](NS(=O)(=O)c1ccc(C)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H20F3NO5S3/c1-4-24-14(21)12(27-15(26)25-5-2)13(16(17,18)19)20-28(22,23)11-8-6-10(3)7-9-11/h6-9,12-13,20H,4-5H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | DAHAQLCMPUWXKG-STQMWFEESA-N |
| XLogP | 3.19 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|