C17H26NO9PS — CID 54763274
diethyl 2-dimethoxyphosphoryl-3-[(4-methylphenyl)sulfonylamino]butanedioate (PubChem CID 54763274) has the molecular formula C17H26NO9PS and a molecular weight of 451.43 g/mol. Its IUPAC name is diethyl 2-dimethoxyphosphoryl-3-[(4-methylphenyl)sulfonylamino]butanedioate.
| Compound Name | diethyl 2-dimethoxyphosphoryl-3-[(4-methylphenyl)sulfonylamino]butanedioate |
|---|---|
| PubChem CID | 54763274 |
| Molecular Formula | C17H26NO9PS |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | diethyl 2-dimethoxyphosphoryl-3-[(4-methylphenyl)sulfonylamino]butanedioate |
| SMILES | CCOC(=O)C(NS(=O)(=O)c1ccc(C)cc1)C(C(=O)OCC)P(=O)(OC)OC |
| InChI | InChI=1S/C17H26NO9PS/c1-6-26-16(19)14(15(17(20)27-7-2)28(21,24-4)25-5)18-29(22,23)13-10-8-12(3)9-11-13/h8-11,14-15,18H,6-7H2,1-5H3 |
| InChIKey | OPCNFFRLBCWESD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|