C13H20NO6PS — CID 101353551
N-[(2S)-4-dimethoxyphosphoryl-3-oxobutan-2-yl]-4-methylbenzenesulfonamide (PubChem CID 101353551) has the molecular formula C13H20NO6PS and a molecular weight of 349.35 g/mol. Its IUPAC name is N-[(2S)-4-dimethoxyphosphoryl-3-oxobutan-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2S)-4-dimethoxyphosphoryl-3-oxobutan-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 101353551 |
| Molecular Formula | C13H20NO6PS |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | N-[(2S)-4-dimethoxyphosphoryl-3-oxobutan-2-yl]-4-methylbenzenesulfonamide |
| SMILES | COP(=O)(CC(=O)[C@H](C)NS(=O)(=O)c1ccc(C)cc1)OC |
| InChI | InChI=1S/C13H20NO6PS/c1-10-5-7-12(8-6-10)22(17,18)14-11(2)13(15)9-21(16,19-3)20-4/h5-8,11,14H,9H2,1-4H3/t11-/m0/s1 |
| InChIKey | DQGKZNVSNWSRLE-NSHDSACASA-N |
| XLogP | 1.72 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|