C28H34O3SSi — CID 100945072
(Z,2R)-5-[tert-butyl(diphenyl)silyl]oxy-1-(4-methylphenyl)sulfinylpent-3-en-2-ol (PubChem CID 100945072) has the molecular formula C28H34O3SSi and a molecular weight of 478.73 g/mol. Its IUPAC name is (Z,2R)-5-[tert-butyl(diphenyl)silyl]oxy-1-(4-methylphenyl)sulfinylpent-3-en-2-ol.
| Compound Name | (Z,2R)-5-[tert-butyl(diphenyl)silyl]oxy-1-(4-methylphenyl)sulfinylpent-3-en-2-ol |
|---|---|
| PubChem CID | 100945072 |
| Molecular Formula | C28H34O3SSi |
| Molecular Weight | 478.73 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | (Z,2R)-5-[tert-butyl(diphenyl)silyl]oxy-1-(4-methylphenyl)sulfinylpent-3-en-2-ol |
| SMILES | Cc1ccc(S(=O)C[C@H](O)/C=C\CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H34O3SSi/c1-23-17-19-25(20-18-23)32(30)22-24(29)12-11-21-31-33(28(2,3)4,26-13-7-5-8-14-26)27-15-9-6-10-16-27/h5-20,24,29H,21-22H2,1-4H3/b12-11-/t24-,32?/m1/s1 |
| InChIKey | GBZAVYPZJVADNP-HIZSWPHWSA-N |
| XLogP | 4.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.73 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|