C29H37BrO4SSi — CID 101461770
(2S,3R,4R)-4-bromo-5-[tert-butyl(diphenyl)silyl]oxy-3-methyl-1-(4-methylphenyl)sulfinylpentane-2,3-diol (PubChem CID 101461770) has the molecular formula C29H37BrO4SSi and a molecular weight of 589.67 g/mol. Its IUPAC name is (2S,3R,4R)-4-bromo-5-[tert-butyl(diphenyl)silyl]oxy-3-methyl-1-(4-methylphenyl)sulfinylpentane-2,3-diol.
| Compound Name | (2S,3R,4R)-4-bromo-5-[tert-butyl(diphenyl)silyl]oxy-3-methyl-1-(4-methylphenyl)sulfinylpentane-2,3-diol |
|---|---|
| PubChem CID | 101461770 |
| Molecular Formula | C29H37BrO4SSi |
| Molecular Weight | 589.67 g/mol |
| Exact Mass | 588.14 |
| IUPAC Name | (2S,3R,4R)-4-bromo-5-[tert-butyl(diphenyl)silyl]oxy-3-methyl-1-(4-methylphenyl)sulfinylpentane-2,3-diol |
| SMILES | Cc1ccc(S(=O)C[C@@H](O)[C@@](C)(O)[C@H](Br)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H37BrO4SSi/c1-22-16-18-23(19-17-22)35(33)21-27(31)29(5,32)26(30)20-34-36(28(2,3)4,24-12-8-6-9-13-24)25-14-10-7-11-15-25/h6-19,26-27,31-32H,20-21H2,1-5H3/t26-,27-,29+,35?/m1/s1 |
| InChIKey | XDWUUNVIRLKRKL-JEKLYKMWSA-N |
| XLogP | 4.55 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.67 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|