C30H37NO4SSi — CID 23281339
(NZ,R)-N-[[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-4-methylbenzenesulfinamide (PubChem CID 23281339) has the molecular formula C30H37NO4SSi and a molecular weight of 535.78 g/mol. Its IUPAC name is (NZ,R)-N-[[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-4-methylbenzenesulfinamide.
| Compound Name | (NZ,R)-N-[[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-4-methylbenzenesulfinamide |
|---|---|
| PubChem CID | 23281339 |
| Molecular Formula | C30H37NO4SSi |
| Molecular Weight | 535.78 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | (NZ,R)-N-[[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-4-methylbenzenesulfinamide |
| SMILES | Cc1ccc([S@@](=O)/N=C\[C@@H]2OC(C)(C)O[C@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H37NO4SSi/c1-23-17-19-24(20-18-23)36(32)31-21-27-28(35-30(5,6)34-27)22-33-37(29(2,3)4,25-13-9-7-10-14-25)26-15-11-8-12-16-26/h7-21,27-28H,22H2,1-6H3/b31-21-/t27-,28-,36+/m0/s1 |
| InChIKey | DGRPNNQOTQGTNH-DXPPLDSVSA-N |
| XLogP | 5.19 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.78 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|