C15H29N3OSi — CID 131746750
4-[tert-butyl(dimethyl)silyl]oxy-1-(5-methylpyrimidin-2-yl)butan-2-amine (PubChem CID 131746750) has the molecular formula C15H29N3OSi and a molecular weight of 295.50 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-1-(5-methylpyrimidin-2-yl)butan-2-amine.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-1-(5-methylpyrimidin-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 131746750 |
| Molecular Formula | C15H29N3OSi |
| Molecular Weight | 295.50 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-1-(5-methylpyrimidin-2-yl)butan-2-amine |
| SMILES | Cc1cnc(CC(N)CCO[Si](C)(C)C(C)(C)C)nc1 |
| InChI | InChI=1S/C15H29N3OSi/c1-12-10-17-14(18-11-12)9-13(16)7-8-19-20(5,6)15(2,3)4/h10-11,13H,7-9,16H2,1-6H3 |
| InChIKey | YBMFNBAUNYPFQO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|