C15H25F2NOSi — CID 77463781
3-[tert-butyl(dimethyl)silyl]oxy-1-(2,4-difluorophenyl)propan-1-amine (PubChem CID 77463781) has the molecular formula C15H25F2NOSi and a molecular weight of 301.45 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-1-(2,4-difluorophenyl)propan-1-amine.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-1-(2,4-difluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 77463781 |
| Molecular Formula | C15H25F2NOSi |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-1-(2,4-difluorophenyl)propan-1-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCCC(N)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H25F2NOSi/c1-15(2,3)20(4,5)19-9-8-14(18)12-7-6-11(16)10-13(12)17/h6-7,10,14H,8-9,18H2,1-5H3 |
| InChIKey | GJVUJLGLSDEPNT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|