C12H18F2OSi — CID 14811687
tert-butyl-(2,4-difluorophenoxy)-dimethylsilane (PubChem CID 14811687) has the molecular formula C12H18F2OSi and a molecular weight of 244.36 g/mol. Its IUPAC name is tert-butyl-(2,4-difluorophenoxy)-dimethylsilane.
| Compound Name | tert-butyl-(2,4-difluorophenoxy)-dimethylsilane |
|---|---|
| PubChem CID | 14811687 |
| Molecular Formula | C12H18F2OSi |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | tert-butyl-(2,4-difluorophenoxy)-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(F)cc1F |
| InChI | InChI=1S/C12H18F2OSi/c1-12(2,3)16(4,5)15-11-7-6-9(13)8-10(11)14/h6-8H,1-5H3 |
| InChIKey | VPJRYEAISBQZCM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|