C12H17F3OSi — CID 91697441
tert-butyl-dimethyl-(2,3,4-trifluorophenoxy)silane (PubChem CID 91697441) has the molecular formula C12H17F3OSi and a molecular weight of 262.35 g/mol. Its IUPAC name is tert-butyl-dimethyl-(2,3,4-trifluorophenoxy)silane.
| Compound Name | tert-butyl-dimethyl-(2,3,4-trifluorophenoxy)silane |
|---|---|
| PubChem CID | 91697441 |
| Molecular Formula | C12H17F3OSi |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | tert-butyl-dimethyl-(2,3,4-trifluorophenoxy)silane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H17F3OSi/c1-12(2,3)17(4,5)16-9-7-6-8(13)10(14)11(9)15/h6-7H,1-5H3 |
| InChIKey | NLAURVRQLIWZTO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|