methyl 5-amino-5-(2,4-difluorophenyl)pentanoate

C12H15F2NO2 — CID 54927803

IUPACmethyl 5-amino-5-(2,4-difluorophenyl)pentanoate
SMILESCOC(=O)CCCC(N)c1ccc(F)cc1F
InChIInChI=1S/C12H15F2NO2/c1-17-12(16)4-2-3-11(15)9-6-5-8(13)7-10(9)14/h5-7,11H,2-4,15H2,1H3
InChIKeyDULDTWZWIPOWFU-UHFFFAOYSA-N
MW243.25 g/mol
LogP2.31
Rot. Bonds5

About methyl 5-amino-5-(2,4-difluorophenyl)pentanoate

methyl 5-amino-5-(2,4-difluorophenyl)pentanoate (PubChem CID 54927803) has the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. Its IUPAC name is methyl 5-amino-5-(2,4-difluorophenyl)pentanoate.

Molecular Properties

Compound Namemethyl 5-amino-5-(2,4-difluorophenyl)pentanoate
PubChem CID54927803
Molecular FormulaC12H15F2NO2
Molecular Weight243.25 g/mol
Exact Mass243.11
IUPAC Namemethyl 5-amino-5-(2,4-difluorophenyl)pentanoate
SMILESCOC(=O)CCCC(N)c1ccc(F)cc1F
InChIInChI=1S/C12H15F2NO2/c1-17-12(16)4-2-3-11(15)9-6-5-8(13)7-10(9)14/h5-7,11H,2-4,15H2,1H3
InChIKeyDULDTWZWIPOWFU-UHFFFAOYSA-N
XLogP2.31
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.25
LogP ≤ 52.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 5-amino-5-(2,4-difluorophenyl)pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-amino-5-(2,4-difluorophenyl)pentanoate?
The IUPAC name of methyl 5-amino-5-(2,4-difluorophenyl)pentanoate (CID 54927803) is methyl 5-amino-5-(2,4-difluorophenyl)pentanoate.
What is the SMILES notation for methyl 5-amino-5-(2,4-difluorophenyl)pentanoate?
The canonical SMILES for methyl 5-amino-5-(2,4-difluorophenyl)pentanoate is COC(=O)CCCC(N)c1ccc(F)cc1F.
What is the InChIKey of methyl 5-amino-5-(2,4-difluorophenyl)pentanoate?
The InChIKey is DULDTWZWIPOWFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2NO2/c1-17-12(16)4-2-3-11(15)9-6-5-8(13)7-10(9)14/h5-7,11H,2-4,15H2,1H3.
What are the key properties of methyl 5-amino-5-(2,4-difluorophenyl)pentanoate?
methyl 5-amino-5-(2,4-difluorophenyl)pentanoate has a molecular weight of 243.25 g/mol, XLogP of 2.31, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-amino-5-(2,4-difluorophenyl)pentanoate is sourced from PubChem (CID 54927803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).