C18H29NO2 — CID 60860655
methyl 5-amino-5-[2,4-di(propan-2-yl)phenyl]pentanoate (PubChem CID 60860655) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is methyl 5-amino-5-[2,4-di(propan-2-yl)phenyl]pentanoate.
| Compound Name | methyl 5-amino-5-[2,4-di(propan-2-yl)phenyl]pentanoate |
|---|---|
| PubChem CID | 60860655 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | methyl 5-amino-5-[2,4-di(propan-2-yl)phenyl]pentanoate |
| SMILES | COC(=O)CCCC(N)c1ccc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C18H29NO2/c1-12(2)14-9-10-15(16(11-14)13(3)4)17(19)7-6-8-18(20)21-5/h9-13,17H,6-8,19H2,1-5H3 |
| InChIKey | HBJDNWRWIBEKPU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |