C14H30O5S2Si — CID 172731654
[(1S,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(sulfinomethyl)cyclohexyl]methanesulfinic acid (PubChem CID 172731654) has the molecular formula C14H30O5S2Si and a molecular weight of 370.61 g/mol. Its IUPAC name is [(1S,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(sulfinomethyl)cyclohexyl]methanesulfinic acid.
| Compound Name | [(1S,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(sulfinomethyl)cyclohexyl]methanesulfinic acid |
|---|---|
| PubChem CID | 172731654 |
| Molecular Formula | C14H30O5S2Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | [(1S,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(sulfinomethyl)cyclohexyl]methanesulfinic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC[C@H](CS(=O)O)[C@H]1CS(=O)O |
| InChI | InChI=1S/C14H30O5S2Si/c1-14(2,3)22(4,5)19-13-8-6-7-11(9-20(15)16)12(13)10-21(17)18/h11-13H,6-10H2,1-5H3,(H,15,16)(H,17,18)/t11-,12-,13+/m1/s1 |
| InChIKey | HWKVFJHTZBERRA-UPJWGTAASA-N |
| XLogP | 3.24 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|