C13H24Br2O2Si — CID 10573047
tert-butyl-[(2R,3S)-2-(2,2-dibromoethenyl)oxan-3-yl]oxy-dimethylsilane (PubChem CID 10573047) has the molecular formula C13H24Br2O2Si and a molecular weight of 400.23 g/mol. Its IUPAC name is tert-butyl-[(2R,3S)-2-(2,2-dibromoethenyl)oxan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3S)-2-(2,2-dibromoethenyl)oxan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10573047 |
| Molecular Formula | C13H24Br2O2Si |
| Molecular Weight | 400.23 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | tert-butyl-[(2R,3S)-2-(2,2-dibromoethenyl)oxan-3-yl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCCO[C@@H]1C=C(Br)Br |
| InChI | InChI=1S/C13H24Br2O2Si/c1-13(2,3)18(4,5)17-10-7-6-8-16-11(10)9-12(14)15/h9-11H,6-8H2,1-5H3/t10-,11+/m0/s1 |
| InChIKey | IDOPLSLTVNJCQZ-WDEREUQCSA-N |
| XLogP | 5.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.23 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|