C22H35BrO4Si — CID 100947243
(3S)-3-bromo-1-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]-4-phenylmethoxybutan-2-one (PubChem CID 100947243) has the molecular formula C22H35BrO4Si and a molecular weight of 471.51 g/mol. Its IUPAC name is (3S)-3-bromo-1-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]-4-phenylmethoxybutan-2-one.
| Compound Name | (3S)-3-bromo-1-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]-4-phenylmethoxybutan-2-one |
|---|---|
| PubChem CID | 100947243 |
| Molecular Formula | C22H35BrO4Si |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | (3S)-3-bromo-1-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]-4-phenylmethoxybutan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCCO[C@@H]1CC(=O)[C@@H](Br)COCc1ccccc1 |
| InChI | InChI=1S/C22H35BrO4Si/c1-22(2,3)28(4,5)27-20-12-9-13-26-21(20)14-19(24)18(23)16-25-15-17-10-7-6-8-11-17/h6-8,10-11,18,20-21H,9,12-16H2,1-5H3/t18-,20-,21+/m0/s1 |
| InChIKey | SXPIBNMNTRXWRW-SESVDKBCSA-N |
| XLogP | 5.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|