C25H38O5Si — CID 10503562
(3S)-2-[2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]ethynyl]-3-phenylmethoxyoxan-2-ol (PubChem CID 10503562) has the molecular formula C25H38O5Si and a molecular weight of 446.66 g/mol. Its IUPAC name is (3S)-2-[2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]ethynyl]-3-phenylmethoxyoxan-2-ol.
| Compound Name | (3S)-2-[2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]ethynyl]-3-phenylmethoxyoxan-2-ol |
|---|---|
| PubChem CID | 10503562 |
| Molecular Formula | C25H38O5Si |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | (3S)-2-[2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]ethynyl]-3-phenylmethoxyoxan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCCO[C@@H]1C#CC1(O)OCCC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C25H38O5Si/c1-24(2,3)31(4,5)30-22-13-9-17-27-21(22)15-16-25(26)23(14-10-18-29-25)28-19-20-11-7-6-8-12-20/h6-8,11-12,21-23,26H,9-10,13-14,17-19H2,1-5H3/t21-,22+,23+,25?/m1/s1 |
| InChIKey | WRGOBHSLAONBKN-ICIDBNQLSA-N |
| XLogP | 4.64 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|