C22H36O3Si — CID 10785793
trans-(1R,2S)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-2-phenylmethoxycyclohexan-1-ol (PubChem CID 10785793) has the molecular formula C22H36O3Si and a molecular weight of 376.61 g/mol. Its IUPAC name is trans-(1R,2S)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-2-phenylmethoxycyclohexan-1-ol.
| Compound Name | trans-(1R,2S)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-2-phenylmethoxycyclohexan-1-ol |
|---|---|
| PubChem CID | 10785793 |
| Molecular Formula | C22H36O3Si |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | trans-(1R,2S)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-2-phenylmethoxycyclohexan-1-ol |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]1(O)CCCC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H36O3Si/c1-7-19(25-26(5,6)21(2,3)4)22(23)16-12-11-15-20(22)24-17-18-13-9-8-10-14-18/h7-10,13-14,19-20,23H,1,11-12,15-17H2,2-6H3/t19-,20+,22+/m1/s1 |
| InChIKey | JUBAIZVZXKOGBL-URVUXULASA-N |
| XLogP | 5.45 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|