C14H28O4Si — CID 90042024
2-[(3aR,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]ethanol (PubChem CID 90042024) has the molecular formula C14H28O4Si and a molecular weight of 288.46 g/mol. Its IUPAC name is 2-[(3aR,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]ethanol.
| Compound Name | 2-[(3aR,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]ethanol |
|---|---|
| PubChem CID | 90042024 |
| Molecular Formula | C14H28O4Si |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-[(3aR,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]ethanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CO[C@@H]2C(CCO)CO[C@@H]21 |
| InChI | InChI=1S/C14H28O4Si/c1-14(2,3)19(4,5)18-11-9-17-12-10(6-7-15)8-16-13(11)12/h10-13,15H,6-9H2,1-5H3/t10?,11-,12-,13-/m1/s1 |
| InChIKey | AHCIGBGRAJRKKO-KIGPFUIMSA-N |
| XLogP | 2.17 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|