C19H31NO3Si — CID 90286030
(3S,3aR,6R,6aS)-N-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine (PubChem CID 90286030) has the molecular formula C19H31NO3Si and a molecular weight of 349.55 g/mol. Its IUPAC name is (3S,3aR,6R,6aS)-N-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine.
| Compound Name | (3S,3aR,6R,6aS)-N-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine |
|---|---|
| PubChem CID | 90286030 |
| Molecular Formula | C19H31NO3Si |
| Molecular Weight | 349.55 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | (3S,3aR,6R,6aS)-N-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2NCc1ccccc1 |
| InChI | InChI=1S/C19H31NO3Si/c1-19(2,3)24(4,5)23-16-13-22-17-15(12-21-18(16)17)20-11-14-9-7-6-8-10-14/h6-10,15-18,20H,11-13H2,1-5H3/t15-,16+,17+,18+/m0/s1 |
| InChIKey | XFMCYTNWWMYMNJ-BSDSXHPESA-N |
| XLogP | 3.33 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|