About [3-[tert-butyl(dimethyl)silyl]oxycyclohepten-1-yl] prop-2-enyl carbonate
[3-[tert-butyl(dimethyl)silyl]oxycyclohepten-1-yl] prop-2-enyl carbonate (PubChem CID 117070940) has the molecular formula C17H30O4Si
and a molecular weight of 326.51 g/mol. Its IUPAC name is [3-[tert-butyl(dimethyl)silyl]oxycyclohepten-1-yl] prop-2-enyl carbonate.
Molecular Properties
| Compound Name | [3-[tert-butyl(dimethyl)silyl]oxycyclohepten-1-yl] prop-2-enyl carbonate |
| PubChem CID | 117070940 |
| Molecular Formula | C17H30O4Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | [3-[tert-butyl(dimethyl)silyl]oxycyclohepten-1-yl] prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)OC1=CC(O[Si](C)(C)C(C)(C)C)CCCC1 |
| InChI | InChI=1S/C17H30O4Si/c1-7-12-19-16(18)20-14-10-8-9-11-15(13-14)21-22(5,6)17(2,3)4/h7,13,15H,1,8-12H2,2-6H3 |
| InChIKey | HAUNCUYSJIFFDH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [3-[tert-butyl(dimethyl)silyl]oxycyclohepten-1-yl] prop-2-enyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[tert-butyl(dimethyl)silyl]oxycyclohepten-1-yl] prop-2-enyl carbonate?
The IUPAC name of [3-[tert-butyl(dimethyl)silyl]oxycyclohepten-1-yl] prop-2-enyl carbonate (CID 117070940) is [3-[tert-butyl(dimethyl)silyl]oxycyclohepten-1-yl] prop-2-enyl carbonate.
What is the SMILES notation for [3-[tert-butyl(dimethyl)silyl]oxycyclohepten-1-yl] prop-2-enyl carbonate?
The canonical SMILES for [3-[tert-butyl(dimethyl)silyl]oxycyclohepten-1-yl] prop-2-enyl carbonate is C=CCOC(=O)OC1=CC(O[Si](C)(C)C(C)(C)C)CCCC1.
What is the InChIKey of [3-[tert-butyl(dimethyl)silyl]oxycyclohepten-1-yl] prop-2-enyl carbonate?
The InChIKey is HAUNCUYSJIFFDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O4Si/c1-7-12-19-16(18)20-14-10-8-9-11-15(13-14)21-22(5,6)17(2,3)4/h7,13,15H,1,8-12H2,2-6H3.
What are the key properties of [3-[tert-butyl(dimethyl)silyl]oxycyclohepten-1-yl] prop-2-enyl carbonate?
[3-[tert-butyl(dimethyl)silyl]oxycyclohepten-1-yl] prop-2-enyl carbonate has a molecular weight of 326.51 g/mol, XLogP of 5.17, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[tert-butyl(dimethyl)silyl]oxycyclohepten-1-yl] prop-2-enyl carbonate is sourced from PubChem (CID 117070940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).