C24H28N2O6S2 — CID 71500273
[(3R)-3-[[S-(4-methylphenyl)-N-(4-methylphenyl)sulfonylsulfonimidoyl]amino]cyclohexen-1-yl] prop-2-enyl carbonate (PubChem CID 71500273) has the molecular formula C24H28N2O6S2 and a molecular weight of 504.63 g/mol. Its IUPAC name is [(3R)-3-[[S-(4-methylphenyl)-N-(4-methylphenyl)sulfonylsulfonimidoyl]amino]cyclohexen-1-yl] prop-2-enyl carbonate.
| Compound Name | [(3R)-3-[[S-(4-methylphenyl)-N-(4-methylphenyl)sulfonylsulfonimidoyl]amino]cyclohexen-1-yl] prop-2-enyl carbonate |
|---|---|
| PubChem CID | 71500273 |
| Molecular Formula | C24H28N2O6S2 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | [(3R)-3-[[S-(4-methylphenyl)-N-(4-methylphenyl)sulfonylsulfonimidoyl]amino]cyclohexen-1-yl] prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)OC1=C[C@H](NS(=O)(=NS(=O)(=O)c2ccc(C)cc2)c2ccc(C)cc2)CCC1 |
| InChI | InChI=1S/C24H28N2O6S2/c1-4-16-31-24(27)32-21-7-5-6-20(17-21)25-33(28,22-12-8-18(2)9-13-22)26-34(29,30)23-14-10-19(3)11-15-23/h4,8-15,17,20H,1,5-7,16H2,2-3H3,(H,25,26,28)/t20-,33?/m1/s1 |
| InChIKey | GXFIJZWFXCZYGZ-SMAGUSHISA-N |
| XLogP | 4.80 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|