About tert-butyl N-[(cyclohexylamino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]carbamate
tert-butyl N-[(cyclohexylamino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]carbamate (PubChem CID 46222281) has the molecular formula C18H28N2O3S
and a molecular weight of 352.50 g/mol. Its IUPAC name is tert-butyl N-[(cyclohexylamino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(cyclohexylamino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]carbamate |
| PubChem CID | 46222281 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | tert-butyl N-[(cyclohexylamino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]carbamate |
| SMILES | Cc1ccc(S(=O)(=NC(=O)OC(C)(C)C)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C18H28N2O3S/c1-14-10-12-16(13-11-14)24(22,19-15-8-6-5-7-9-15)20-17(21)23-18(2,3)4/h10-13,15H,5-9H2,1-4H3,(H,19,20,21,22) |
| InChIKey | DLPAUHLTWOOXQF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-[(cyclohexylamino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(cyclohexylamino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]carbamate?
The IUPAC name of tert-butyl N-[(cyclohexylamino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]carbamate (CID 46222281) is tert-butyl N-[(cyclohexylamino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]carbamate.
What is the SMILES notation for tert-butyl N-[(cyclohexylamino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]carbamate?
The canonical SMILES for tert-butyl N-[(cyclohexylamino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]carbamate is Cc1ccc(S(=O)(=NC(=O)OC(C)(C)C)NC2CCCCC2)cc1.
What is the InChIKey of tert-butyl N-[(cyclohexylamino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]carbamate?
The InChIKey is DLPAUHLTWOOXQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O3S/c1-14-10-12-16(13-11-14)24(22,19-15-8-6-5-7-9-15)20-17(21)23-18(2,3)4/h10-13,15H,5-9H2,1-4H3,(H,19,20,21,22).
What are the key properties of tert-butyl N-[(cyclohexylamino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]carbamate?
tert-butyl N-[(cyclohexylamino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]carbamate has a molecular weight of 352.50 g/mol, XLogP of 4.59, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(cyclohexylamino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]carbamate is sourced from PubChem (CID 46222281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).