C21H31NO4S — CID 102169340
tert-butyl 2-[(S)-cyclohexyl-[(4-methylphenyl)sulfonylamino]methyl]prop-2-enoate (PubChem CID 102169340) has the molecular formula C21H31NO4S and a molecular weight of 393.55 g/mol. Its IUPAC name is tert-butyl 2-[(S)-cyclohexyl-[(4-methylphenyl)sulfonylamino]methyl]prop-2-enoate.
| Compound Name | tert-butyl 2-[(S)-cyclohexyl-[(4-methylphenyl)sulfonylamino]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 102169340 |
| Molecular Formula | C21H31NO4S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | tert-butyl 2-[(S)-cyclohexyl-[(4-methylphenyl)sulfonylamino]methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC(C)(C)C)[C@@H](NS(=O)(=O)c1ccc(C)cc1)C1CCCCC1 |
| InChI | InChI=1S/C21H31NO4S/c1-15-11-13-18(14-12-15)27(24,25)22-19(17-9-7-6-8-10-17)16(2)20(23)26-21(3,4)5/h11-14,17,19,22H,2,6-10H2,1,3-5H3/t19-/m1/s1 |
| InChIKey | BCRFUTSDQRRIEC-LJQANCHMSA-N |
| XLogP | 4.12 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|