C14H24O3 — CID 15091153
tert-butyl 2-[cyclohexyl(hydroxy)methyl]prop-2-enoate (PubChem CID 15091153) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is tert-butyl 2-[cyclohexyl(hydroxy)methyl]prop-2-enoate.
| Compound Name | tert-butyl 2-[cyclohexyl(hydroxy)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 15091153 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | tert-butyl 2-[cyclohexyl(hydroxy)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC(C)(C)C)C(O)C1CCCCC1 |
| InChI | InChI=1S/C14H24O3/c1-10(13(16)17-14(2,3)4)12(15)11-8-6-5-7-9-11/h11-12,15H,1,5-9H2,2-4H3 |
| InChIKey | LUSXKLPBNVINHK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|