C9H13F3O3 — CID 178152991
tert-butyl 4,4,4-trifluoro-3-hydroxy-2-methylidenebutanoate (PubChem CID 178152991) has the molecular formula C9H13F3O3 and a molecular weight of 226.19 g/mol. Its IUPAC name is tert-butyl 4,4,4-trifluoro-3-hydroxy-2-methylidenebutanoate.
| Compound Name | tert-butyl 4,4,4-trifluoro-3-hydroxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 178152991 |
| Molecular Formula | C9H13F3O3 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | tert-butyl 4,4,4-trifluoro-3-hydroxy-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OC(C)(C)C)C(O)C(F)(F)F |
| InChI | InChI=1S/C9H13F3O3/c1-5(6(13)9(10,11)12)7(14)15-8(2,3)4/h6,13H,1H2,2-4H3 |
| InChIKey | ZTGHRRYXLNWTJH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|