C14H17BrO3 — CID 11301442
tert-butyl 2-[(4-bromophenyl)-hydroxymethyl]prop-2-enoate (PubChem CID 11301442) has the molecular formula C14H17BrO3 and a molecular weight of 313.19 g/mol. Its IUPAC name is tert-butyl 2-[(4-bromophenyl)-hydroxymethyl]prop-2-enoate.
| Compound Name | tert-butyl 2-[(4-bromophenyl)-hydroxymethyl]prop-2-enoate |
|---|---|
| PubChem CID | 11301442 |
| Molecular Formula | C14H17BrO3 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | tert-butyl 2-[(4-bromophenyl)-hydroxymethyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC(C)(C)C)C(O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H17BrO3/c1-9(13(17)18-14(2,3)4)12(16)10-5-7-11(15)8-6-10/h5-8,12,16H,1H2,2-4H3 |
| InChIKey | MKWRYVFEERKBBE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|