C18H21BrF2O4 — CID 162404647
5-O-tert-butyl 1-O-ethyl (3S)-3-(4-bromophenyl)-2,2-difluoro-4-methylidenepentanedioate (PubChem CID 162404647) has the molecular formula C18H21BrF2O4 and a molecular weight of 419.26 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-ethyl (3S)-3-(4-bromophenyl)-2,2-difluoro-4-methylidenepentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-ethyl (3S)-3-(4-bromophenyl)-2,2-difluoro-4-methylidenepentanedioate |
|---|---|
| PubChem CID | 162404647 |
| Molecular Formula | C18H21BrF2O4 |
| Molecular Weight | 419.26 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 5-O-tert-butyl 1-O-ethyl (3S)-3-(4-bromophenyl)-2,2-difluoro-4-methylidenepentanedioate |
| SMILES | C=C(C(=O)OC(C)(C)C)[C@H](c1ccc(Br)cc1)C(F)(F)C(=O)OCC |
| InChI | InChI=1S/C18H21BrF2O4/c1-6-24-16(23)18(20,21)14(12-7-9-13(19)10-8-12)11(2)15(22)25-17(3,4)5/h7-10,14H,2,6H2,1,3-5H3/t14-/m1/s1 |
| InChIKey | KUYNOUZOAHDGNQ-CQSZACIVSA-N |
| XLogP | 4.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.26 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|