About 4-bromobenzaldehyde;methyl 2-[(4-bromophenyl)-hydroxymethyl]prop-2-enoate
4-bromobenzaldehyde;methyl 2-[(4-bromophenyl)-hydroxymethyl]prop-2-enoate (PubChem CID 160757288) has the molecular formula C18H16Br2O4
and a molecular weight of 456.13 g/mol. Its IUPAC name is 4-bromobenzaldehyde;methyl 2-[(4-bromophenyl)-hydroxymethyl]prop-2-enoate.
Molecular Properties
| Compound Name | 4-bromobenzaldehyde;methyl 2-[(4-bromophenyl)-hydroxymethyl]prop-2-enoate |
| PubChem CID | 160757288 |
| Molecular Formula | C18H16Br2O4 |
| Molecular Weight | 456.13 g/mol |
| Exact Mass | 453.94 |
| IUPAC Name | 4-bromobenzaldehyde;methyl 2-[(4-bromophenyl)-hydroxymethyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C(O)c1ccc(Br)cc1.O=Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C11H11BrO3.C7H5BrO/c1-7(11(14)15-2)10(13)8-3-5-9(12)6-4-8;8-7-3-1-6(5-9)2-4-7/h3-6,10,13H,1H2,2H3;1-5H |
| InChIKey | RXPGBNPBXNJVSL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.13 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-bromobenzaldehyde;methyl 2-[(4-bromophenyl)-hydroxymethyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromobenzaldehyde;methyl 2-[(4-bromophenyl)-hydroxymethyl]prop-2-enoate?
The IUPAC name of 4-bromobenzaldehyde;methyl 2-[(4-bromophenyl)-hydroxymethyl]prop-2-enoate (CID 160757288) is 4-bromobenzaldehyde;methyl 2-[(4-bromophenyl)-hydroxymethyl]prop-2-enoate.
What is the SMILES notation for 4-bromobenzaldehyde;methyl 2-[(4-bromophenyl)-hydroxymethyl]prop-2-enoate?
The canonical SMILES for 4-bromobenzaldehyde;methyl 2-[(4-bromophenyl)-hydroxymethyl]prop-2-enoate is C=C(C(=O)OC)C(O)c1ccc(Br)cc1.O=Cc1ccc(Br)cc1.
What is the InChIKey of 4-bromobenzaldehyde;methyl 2-[(4-bromophenyl)-hydroxymethyl]prop-2-enoate?
The InChIKey is RXPGBNPBXNJVSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrO3.C7H5BrO/c1-7(11(14)15-2)10(13)8-3-5-9(12)6-4-8;8-7-3-1-6(5-9)2-4-7/h3-6,10,13H,1H2,2H3;1-5H.
What are the key properties of 4-bromobenzaldehyde;methyl 2-[(4-bromophenyl)-hydroxymethyl]prop-2-enoate?
4-bromobenzaldehyde;methyl 2-[(4-bromophenyl)-hydroxymethyl]prop-2-enoate has a molecular weight of 456.13 g/mol, XLogP of 4.47, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromobenzaldehyde;methyl 2-[(4-bromophenyl)-hydroxymethyl]prop-2-enoate is sourced from PubChem (CID 160757288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).