About bis(4-bromobenzaldehyde);hydrate
bis(4-bromobenzaldehyde);hydrate (PubChem CID 174866505) has the molecular formula C14H12Br2O3
and a molecular weight of 388.06 g/mol. Its IUPAC name is bis(4-bromobenzaldehyde);hydrate.
Molecular Properties
| Compound Name | bis(4-bromobenzaldehyde);hydrate |
| PubChem CID | 174866505 |
| Molecular Formula | C14H12Br2O3 |
| Molecular Weight | 388.06 g/mol |
| Exact Mass | 385.92 |
| IUPAC Name | bis(4-bromobenzaldehyde);hydrate |
| SMILES | O.O=Cc1ccc(Br)cc1.O=Cc1ccc(Br)cc1 |
| InChI | InChI=1S/2C7H5BrO.H2O/c2*8-7-3-1-6(5-9)2-4-7;/h2*1-5H;1H2 |
| InChIKey | JKEFRLYAKCYSMS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 65.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.06 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze bis(4-bromobenzaldehyde);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-bromobenzaldehyde);hydrate?
The IUPAC name of bis(4-bromobenzaldehyde);hydrate (CID 174866505) is bis(4-bromobenzaldehyde);hydrate.
What is the SMILES notation for bis(4-bromobenzaldehyde);hydrate?
The canonical SMILES for bis(4-bromobenzaldehyde);hydrate is O.O=Cc1ccc(Br)cc1.O=Cc1ccc(Br)cc1.
What is the InChIKey of bis(4-bromobenzaldehyde);hydrate?
The InChIKey is JKEFRLYAKCYSMS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H5BrO.H2O/c2*8-7-3-1-6(5-9)2-4-7;/h2*1-5H;1H2.
What are the key properties of bis(4-bromobenzaldehyde);hydrate?
bis(4-bromobenzaldehyde);hydrate has a molecular weight of 388.06 g/mol, XLogP of 3.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-bromobenzaldehyde);hydrate is sourced from PubChem (CID 174866505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).