About 4-bromobenzaldehyde;4-cyclopropylbenzaldehyde;cyclopropylboronic acid
4-bromobenzaldehyde;4-cyclopropylbenzaldehyde;cyclopropylboronic acid (PubChem CID 160651419) has the molecular formula C20H22BBrO4
and a molecular weight of 417.11 g/mol. Its IUPAC name is 4-bromobenzaldehyde;4-cyclopropylbenzaldehyde;cyclopropylboronic acid.
Molecular Properties
| Compound Name | 4-bromobenzaldehyde;4-cyclopropylbenzaldehyde;cyclopropylboronic acid |
| PubChem CID | 160651419 |
| Molecular Formula | C20H22BBrO4 |
| Molecular Weight | 417.11 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 4-bromobenzaldehyde;4-cyclopropylbenzaldehyde;cyclopropylboronic acid |
| SMILES | O=Cc1ccc(Br)cc1.O=Cc1ccc(C2CC2)cc1.OB(O)C1CC1 |
| InChI | InChI=1S/C10H10O.C7H5BrO.C3H7BO2/c11-7-8-1-3-9(4-2-8)10-5-6-10;8-7-3-1-6(5-9)2-4-7;5-4(6)3-1-2-3/h1-4,7,10H,5-6H2;1-5H;3,5-6H,1-2H2 |
| InChIKey | RKLWQKQMNSEYAY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.11 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-bromobenzaldehyde;4-cyclopropylbenzaldehyde;cyclopropylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromobenzaldehyde;4-cyclopropylbenzaldehyde;cyclopropylboronic acid?
The IUPAC name of 4-bromobenzaldehyde;4-cyclopropylbenzaldehyde;cyclopropylboronic acid (CID 160651419) is 4-bromobenzaldehyde;4-cyclopropylbenzaldehyde;cyclopropylboronic acid.
What is the SMILES notation for 4-bromobenzaldehyde;4-cyclopropylbenzaldehyde;cyclopropylboronic acid?
The canonical SMILES for 4-bromobenzaldehyde;4-cyclopropylbenzaldehyde;cyclopropylboronic acid is O=Cc1ccc(Br)cc1.O=Cc1ccc(C2CC2)cc1.OB(O)C1CC1.
What is the InChIKey of 4-bromobenzaldehyde;4-cyclopropylbenzaldehyde;cyclopropylboronic acid?
The InChIKey is RKLWQKQMNSEYAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O.C7H5BrO.C3H7BO2/c11-7-8-1-3-9(4-2-8)10-5-6-10;8-7-3-1-6(5-9)2-4-7;5-4(6)3-1-2-3/h1-4,7,10H,5-6H2;1-5H;3,5-6H,1-2H2.
What are the key properties of 4-bromobenzaldehyde;4-cyclopropylbenzaldehyde;cyclopropylboronic acid?
4-bromobenzaldehyde;4-cyclopropylbenzaldehyde;cyclopropylboronic acid has a molecular weight of 417.11 g/mol, XLogP of 4.26, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromobenzaldehyde;4-cyclopropylbenzaldehyde;cyclopropylboronic acid is sourced from PubChem (CID 160651419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).