C17H24F6O5 — CID 101397562
5-O-tert-butyl 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) (3S,4R)-3-hydroxy-2-methylidene-4-(2-methylpropyl)pentanedioate (PubChem CID 101397562) has the molecular formula C17H24F6O5 and a molecular weight of 422.36 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) (3S,4R)-3-hydroxy-2-methylidene-4-(2-methylpropyl)pentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) (3S,4R)-3-hydroxy-2-methylidene-4-(2-methylpropyl)pentanedioate |
|---|---|
| PubChem CID | 101397562 |
| Molecular Formula | C17H24F6O5 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 5-O-tert-butyl 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) (3S,4R)-3-hydroxy-2-methylidene-4-(2-methylpropyl)pentanedioate |
| SMILES | C=C(C(=O)OC(C(F)(F)F)C(F)(F)F)[C@@H](O)[C@@H](CC(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H24F6O5/c1-8(2)7-10(13(26)28-15(4,5)6)11(24)9(3)12(25)27-14(16(18,19)20)17(21,22)23/h8,10-11,14,24H,3,7H2,1-2,4-6H3/t10-,11-/m1/s1 |
| InChIKey | CZCQBYDCHIINFX-GHMZBOCLSA-N |
| XLogP | 3.94 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|