C22H30F6O4Si — CID 132570553
1,1,1,3,3,3-hexafluoropropan-2-yl (3S,4S,5S)-3-hydroxy-4-methyl-2-methylidene-5-phenyl-5-triethylsilyloxypentanoate (PubChem CID 132570553) has the molecular formula C22H30F6O4Si and a molecular weight of 500.55 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl (3S,4S,5S)-3-hydroxy-4-methyl-2-methylidene-5-phenyl-5-triethylsilyloxypentanoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (3S,4S,5S)-3-hydroxy-4-methyl-2-methylidene-5-phenyl-5-triethylsilyloxypentanoate |
|---|---|
| PubChem CID | 132570553 |
| Molecular Formula | C22H30F6O4Si |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (3S,4S,5S)-3-hydroxy-4-methyl-2-methylidene-5-phenyl-5-triethylsilyloxypentanoate |
| SMILES | C=C(C(=O)OC(C(F)(F)F)C(F)(F)F)[C@@H](O)[C@H](C)[C@H](O[Si](CC)(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C22H30F6O4Si/c1-6-33(7-2,8-3)32-18(16-12-10-9-11-13-16)14(4)17(29)15(5)19(30)31-20(21(23,24)25)22(26,27)28/h9-14,17-18,20,29H,5-8H2,1-4H3/t14-,17-,18-/m0/s1 |
| InChIKey | OBUKCSRCLFYIFY-WBAXXEDZSA-N |
| XLogP | 6.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|