C17H12F6O3 — CID 101382866
1,1,1,3,3,3-hexafluoropropan-2-yl 2-[hydroxy(naphthalen-1-yl)methyl]prop-2-enoate (PubChem CID 101382866) has the molecular formula C17H12F6O3 and a molecular weight of 378.27 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[hydroxy(naphthalen-1-yl)methyl]prop-2-enoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[hydroxy(naphthalen-1-yl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 101382866 |
| Molecular Formula | C17H12F6O3 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[hydroxy(naphthalen-1-yl)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC(C(F)(F)F)C(F)(F)F)C(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H12F6O3/c1-9(14(25)26-15(16(18,19)20)17(21,22)23)13(24)12-8-4-6-10-5-2-3-7-11(10)12/h2-8,13,15,24H,1H2 |
| InChIKey | PGLOYHOTAGIALG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|