C26H30O3Si — CID 71484556
naphthalen-2-yl 2-[phenyl(triethylsilyloxy)methyl]prop-2-enoate (PubChem CID 71484556) has the molecular formula C26H30O3Si and a molecular weight of 418.61 g/mol. Its IUPAC name is naphthalen-2-yl 2-[phenyl(triethylsilyloxy)methyl]prop-2-enoate.
| Compound Name | naphthalen-2-yl 2-[phenyl(triethylsilyloxy)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 71484556 |
| Molecular Formula | C26H30O3Si |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | naphthalen-2-yl 2-[phenyl(triethylsilyloxy)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)Oc1ccc2ccccc2c1)C(O[Si](CC)(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C26H30O3Si/c1-5-30(6-2,7-3)29-25(22-14-9-8-10-15-22)20(4)26(27)28-24-18-17-21-13-11-12-16-23(21)19-24/h8-19,25H,4-7H2,1-3H3 |
| InChIKey | VALRJWGJWNHRQC-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|