About 1-O-(2-fluoroprop-2-enyl) 2-O-naphthalen-2-yl oxalate
1-O-(2-fluoroprop-2-enyl) 2-O-naphthalen-2-yl oxalate (PubChem CID 138664639) has the molecular formula C15H11FO4
and a molecular weight of 274.25 g/mol. Its IUPAC name is 1-O-(2-fluoroprop-2-enyl) 2-O-naphthalen-2-yl oxalate.
Molecular Properties
| Compound Name | 1-O-(2-fluoroprop-2-enyl) 2-O-naphthalen-2-yl oxalate |
| PubChem CID | 138664639 |
| Molecular Formula | C15H11FO4 |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 1-O-(2-fluoroprop-2-enyl) 2-O-naphthalen-2-yl oxalate |
| SMILES | C=C(F)COC(=O)C(=O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H11FO4/c1-10(16)9-19-14(17)15(18)20-13-7-6-11-4-2-3-5-12(11)8-13/h2-8H,1,9H2 |
| InChIKey | BWOYXNBUGKHPSA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(2-fluoroprop-2-enyl) 2-O-naphthalen-2-yl oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(2-fluoroprop-2-enyl) 2-O-naphthalen-2-yl oxalate?
The IUPAC name of 1-O-(2-fluoroprop-2-enyl) 2-O-naphthalen-2-yl oxalate (CID 138664639) is 1-O-(2-fluoroprop-2-enyl) 2-O-naphthalen-2-yl oxalate.
What is the SMILES notation for 1-O-(2-fluoroprop-2-enyl) 2-O-naphthalen-2-yl oxalate?
The canonical SMILES for 1-O-(2-fluoroprop-2-enyl) 2-O-naphthalen-2-yl oxalate is C=C(F)COC(=O)C(=O)Oc1ccc2ccccc2c1.
What is the InChIKey of 1-O-(2-fluoroprop-2-enyl) 2-O-naphthalen-2-yl oxalate?
The InChIKey is BWOYXNBUGKHPSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11FO4/c1-10(16)9-19-14(17)15(18)20-13-7-6-11-4-2-3-5-12(11)8-13/h2-8H,1,9H2.
What are the key properties of 1-O-(2-fluoroprop-2-enyl) 2-O-naphthalen-2-yl oxalate?
1-O-(2-fluoroprop-2-enyl) 2-O-naphthalen-2-yl oxalate has a molecular weight of 274.25 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(2-fluoroprop-2-enyl) 2-O-naphthalen-2-yl oxalate is sourced from PubChem (CID 138664639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).