C25H21NO6S — CID 102389708
naphthalen-2-yl 2-[(R)-furan-3-yl-[(4-methoxyphenyl)sulfonylamino]methyl]prop-2-enoate (PubChem CID 102389708) has the molecular formula C25H21NO6S and a molecular weight of 463.51 g/mol. Its IUPAC name is naphthalen-2-yl 2-[(R)-furan-3-yl-[(4-methoxyphenyl)sulfonylamino]methyl]prop-2-enoate.
| Compound Name | naphthalen-2-yl 2-[(R)-furan-3-yl-[(4-methoxyphenyl)sulfonylamino]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 102389708 |
| Molecular Formula | C25H21NO6S |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | naphthalen-2-yl 2-[(R)-furan-3-yl-[(4-methoxyphenyl)sulfonylamino]methyl]prop-2-enoate |
| SMILES | C=C(C(=O)Oc1ccc2ccccc2c1)[C@H](NS(=O)(=O)c1ccc(OC)cc1)c1ccoc1 |
| InChI | InChI=1S/C25H21NO6S/c1-17(25(27)32-22-8-7-18-5-3-4-6-19(18)15-22)24(20-13-14-31-16-20)26-33(28,29)23-11-9-21(30-2)10-12-23/h3-16,24,26H,1H2,2H3/t24-/m0/s1 |
| InChIKey | HYFUYYZLGICWOY-DEOSSOPVSA-N |
| XLogP | 4.62 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|