C21H36O4Si — CID 132570563
ethyl (2S,3S,4R,5S)-3-hydroxy-2,4-dimethyl-5-phenyl-5-triethylsilyloxypentanoate (PubChem CID 132570563) has the molecular formula C21H36O4Si and a molecular weight of 380.60 g/mol. Its IUPAC name is ethyl (2S,3S,4R,5S)-3-hydroxy-2,4-dimethyl-5-phenyl-5-triethylsilyloxypentanoate.
| Compound Name | ethyl (2S,3S,4R,5S)-3-hydroxy-2,4-dimethyl-5-phenyl-5-triethylsilyloxypentanoate |
|---|---|
| PubChem CID | 132570563 |
| Molecular Formula | C21H36O4Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | ethyl (2S,3S,4R,5S)-3-hydroxy-2,4-dimethyl-5-phenyl-5-triethylsilyloxypentanoate |
| SMILES | CCOC(=O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](O[Si](CC)(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C21H36O4Si/c1-7-24-21(23)17(6)19(22)16(5)20(18-14-12-11-13-15-18)25-26(8-2,9-3)10-4/h11-17,19-20,22H,7-10H2,1-6H3/t16-,17+,19+,20+/m1/s1 |
| InChIKey | CUXCBFHULVOCPF-UMGGQSCQSA-N |
| XLogP | 4.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|