C9H16F3NO3 — CID 150203117
tert-butyl (2R,3R)-3-amino-4,4,4-trifluoro-2-methoxybutanoate (PubChem CID 150203117) has the molecular formula C9H16F3NO3 and a molecular weight of 243.22 g/mol. Its IUPAC name is tert-butyl (2R,3R)-3-amino-4,4,4-trifluoro-2-methoxybutanoate.
| Compound Name | tert-butyl (2R,3R)-3-amino-4,4,4-trifluoro-2-methoxybutanoate |
|---|---|
| PubChem CID | 150203117 |
| Molecular Formula | C9H16F3NO3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | tert-butyl (2R,3R)-3-amino-4,4,4-trifluoro-2-methoxybutanoate |
| SMILES | CO[C@@H](C(=O)OC(C)(C)C)[C@@H](N)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO3/c1-8(2,3)16-7(14)5(15-4)6(13)9(10,11)12/h5-6H,13H2,1-4H3/t5-,6-/m1/s1 |
| InChIKey | FPXIEPCVSSBHCK-PHDIDXHHSA-N |
| XLogP | 1.23 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |