C15H29O3S+ — CID 11372296
[(1R,2S)-1-cyclohexyl-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]-3-oxopropan-2-yl]-dimethylsulfanium (PubChem CID 11372296) has the molecular formula C15H29O3S+ and a molecular weight of 289.46 g/mol. Its IUPAC name is [(1R,2S)-1-cyclohexyl-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]-3-oxopropan-2-yl]-dimethylsulfanium.
| Compound Name | [(1R,2S)-1-cyclohexyl-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]-3-oxopropan-2-yl]-dimethylsulfanium |
|---|---|
| PubChem CID | 11372296 |
| Molecular Formula | C15H29O3S+ |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | [(1R,2S)-1-cyclohexyl-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]-3-oxopropan-2-yl]-dimethylsulfanium |
| SMILES | C[S+](C)[C@H](C(=O)OC(C)(C)C)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C15H29O3S/c1-15(2,3)18-14(17)13(19(4)5)12(16)11-9-7-6-8-10-11/h11-13,16H,6-10H2,1-5H3/q+1/t12-,13+/m1/s1 |
| InChIKey | GFNUKWUDHCUIJB-OLZOCXBDSA-N |
| XLogP | 2.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|