C20H26NO3S — CID 10928938
CID 10928938 (PubChem CID 10928938) has the molecular formula C20H26NO3S and a molecular weight of 360.50 g/mol.
| Compound Name | CID 10928938 |
|---|---|
| PubChem CID | 10928938 |
| Molecular Formula | C20H26NO3S |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | — |
| SMILES | Cc1ccc(S(=O)(=O)NC([C]2[CH][CH][CH][CH]2)C(O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C20H26NO3S/c1-15-11-13-18(14-12-15)25(23,24)21-19(16-7-5-6-8-16)20(22)17-9-3-2-4-10-17/h5-8,11-14,17,19-22H,2-4,9-10H2,1H3 |
| InChIKey | UCTRFQPWZPCMRE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |