About CID 11124300
CID 11124300 (PubChem CID 11124300) has the molecular formula C23H24NO4S
and a molecular weight of 410.52 g/mol.
Molecular Properties
| Compound Name | CID 11124300 |
| PubChem CID | 11124300 |
| Molecular Formula | C23H24NO4S |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | — |
| SMILES | CC(=O)O[C@@H](c1ccccc1C)[C@H](NS(=O)(=O)c1ccc(C)cc1)[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C23H24NO4S/c1-16-12-14-20(15-13-16)29(26,27)24-22(19-9-5-6-10-19)23(28-18(3)25)21-11-7-4-8-17(21)2/h4-15,22-24H,1-3H3/t22-,23+/m1/s1 |
| InChIKey | RYJRFALQDMCCBL-PKTZIBPZSA-N |
| XLogP | 3.66 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 11124300 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11124300?
The IUPAC name of CID 11124300 (CID 11124300) is not available.
What is the SMILES notation for CID 11124300?
The canonical SMILES for CID 11124300 is CC(=O)O[C@@H](c1ccccc1C)[C@H](NS(=O)(=O)c1ccc(C)cc1)[C]1[CH][CH][CH][CH]1.
What is the InChIKey of CID 11124300?
The InChIKey is RYJRFALQDMCCBL-PKTZIBPZSA-N. The full InChI is InChI=1S/C23H24NO4S/c1-16-12-14-20(15-13-16)29(26,27)24-22(19-9-5-6-10-19)23(28-18(3)25)21-11-7-4-8-17(21)2/h4-15,22-24H,1-3H3/t22-,23+/m1/s1.
What are the key properties of CID 11124300?
CID 11124300 has a molecular weight of 410.52 g/mol, XLogP of 3.66, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11124300 is sourced from PubChem (CID 11124300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).