C15H21NO5S — CID 10404177
[(1S)-1-[(2S,3S)-3-[(1R)-1-[(4-methylphenyl)sulfonylamino]ethyl]oxiran-2-yl]ethyl] acetate (PubChem CID 10404177) has the molecular formula C15H21NO5S and a molecular weight of 327.40 g/mol. Its IUPAC name is [(1S)-1-[(2S,3S)-3-[(1R)-1-[(4-methylphenyl)sulfonylamino]ethyl]oxiran-2-yl]ethyl] acetate.
| Compound Name | [(1S)-1-[(2S,3S)-3-[(1R)-1-[(4-methylphenyl)sulfonylamino]ethyl]oxiran-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 10404177 |
| Molecular Formula | C15H21NO5S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | [(1S)-1-[(2S,3S)-3-[(1R)-1-[(4-methylphenyl)sulfonylamino]ethyl]oxiran-2-yl]ethyl] acetate |
| SMILES | CC(=O)O[C@@H](C)[C@@H]1O[C@H]1[C@@H](C)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H21NO5S/c1-9-5-7-13(8-6-9)22(18,19)16-10(2)14-15(21-14)11(3)20-12(4)17/h5-8,10-11,14-16H,1-4H3/t10-,11+,14+,15+/m1/s1 |
| InChIKey | PHHRTCJWKZQXMI-PKIAMQTDSA-N |
| XLogP | 1.38 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|